CymitQuimica logo

CAS 1313712-11-6

:

N-[6-(2-Bromoacetyl)-3-pyridazinyl]acetamide

Description:
N-[6-(2-Bromoacetyl)-3-pyridazinyl]acetamide is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with a bromoacetyl group and an acetamide moiety. This compound typically exhibits properties associated with both the pyridazine and acetamide functional groups, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the amide group. The presence of the bromine atom may impart specific reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, the stability, reactivity, and biological properties can be influenced by environmental factors such as pH and temperature. Proper handling and safety measures should be observed due to the presence of bromine, which can be hazardous.
Formula:C8H8BrN3O2
InChI:InChI=1S/C8H8BrN3O2/c1-5(13)10-8-3-2-6(11-12-8)7(14)4-9/h2-3H,4H2,1H3,(H,10,12,13)
InChI key:InChIKey=WOJCPHWDHSCKIO-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC=C(C(CBr)=O)N=N1
Synonyms:
  • Acetamide, N-[6-(2-bromoacetyl)-3-pyridazinyl]-
  • N-[6-(2-Bromoacetyl)-3-pyridazinyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.