CymitQuimica logo

CAS 1313712-16-1

:

4-[2-[[2-(Trimethylsilyl)ethoxy]methyl]-2H-tetrazol-5-yl]benzeneethanol

Description:
4-[2-[[2-(Trimethylsilyl)ethoxy]methyl]-2H-tetrazol-5-yl]benzeneethanol, with the CAS number 1313712-16-1, is a chemical compound characterized by its complex structure, which includes a benzene ring, a tetrazole moiety, and a trimethylsilyl group. The presence of the tetrazole ring suggests potential applications in pharmaceuticals, particularly in the development of bioactive compounds due to its ability to mimic carboxylic acids. The trimethylsilyl group enhances the compound's stability and solubility, making it suitable for various chemical reactions and applications. Additionally, the ethoxy group contributes to the compound's overall hydrophobicity, influencing its interaction with biological systems. This compound may exhibit interesting properties such as potential antimicrobial or antifungal activity, although specific biological activities would require further investigation. Its unique structural features make it a candidate for research in medicinal chemistry and materials science, where modifications to its structure could lead to the development of novel therapeutic agents or functional materials.
Formula:C15H24N4O2Si
InChI:InChI=1S/C15H24N4O2Si/c1-22(2,3)11-10-21-12-19-17-15(16-18-19)14-6-4-13(5-7-14)8-9-20/h4-7,20H,8-12H2,1-3H3
InChI key:InChIKey=ZPNDJISJQAOGHA-UHFFFAOYSA-N
SMILES:C(OCC[Si](C)(C)C)N1N=C(N=N1)C2=CC=C(CCO)C=C2
Synonyms:
  • Benzeneethanol, 4-[2-[[2-(trimethylsilyl)ethoxy]methyl]-2H-tetrazol-5-yl]-
  • 4-[2-[[2-(Trimethylsilyl)ethoxy]methyl]-2H-tetrazol-5-yl]benzeneethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.