CymitQuimica logo

CAS 1313712-18-3

:

6-Bromo-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-1,2,3-triazolo[4,5-b]pyridine

Description:
6-Bromo-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-1,2,3-triazolo[4,5-b]pyridine is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety. The presence of a bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations. The trimethylsilyl group enhances the compound's stability and solubility, while the ethoxy group contributes to its overall polarity. This compound may exhibit interesting biological activities due to its unique structural features, which can influence its interaction with biological targets. Additionally, the presence of multiple functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through spectroscopic methods. Overall, this compound represents a valuable structure in the field of organic synthesis and drug development, warranting further investigation into its chemical behavior and potential applications.
Formula:C11H17BrN4OSi
InChI:InChI=1S/C11H17BrN4OSi/c1-18(2,3)5-4-17-8-16-10-6-9(12)7-13-11(10)14-15-16/h6-7H,4-5,8H2,1-3H3
InChI key:InChIKey=IFUKSOSLGPJPHG-UHFFFAOYSA-N
SMILES:C(OCC[Si](C)(C)C)N1C=2C(N=N1)=NC=C(Br)C2
Synonyms:
  • 1H-1,2,3-Triazolo[4,5-b]pyridine, 6-bromo-1-[[2-(trimethylsilyl)ethoxy]methyl]-
  • 6-Bromo-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-1,2,3-triazolo[4,5-b]pyridine
  • 2-[(6-Bromotriazolo[4,5-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane
  • 6-Bromo-1-[[2-(trimethylsilyl)ethoxy]methyl]-1H-[1,2,3]triazolo[4,5-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.