CAS 1313712-32-1
:1H-Pyrido[2,3-b][1,4]oxazin-2-ol
Description:
1H-Pyrido[2,3-b][1,4]oxazin-2-ol is a heterocyclic organic compound characterized by its fused ring structure, which includes a pyridine and an oxazine moiety. This compound typically exhibits a range of chemical properties due to the presence of both nitrogen and oxygen atoms in its structure, contributing to its potential reactivity and biological activity. It is often studied for its pharmacological properties, as heterocycles like this one can serve as scaffolds for drug development. The hydroxyl group (-OH) at the 2-position enhances its solubility in polar solvents and may influence its interaction with biological targets. Additionally, the compound may exhibit fluorescence, making it useful in various analytical applications. Its synthesis often involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography. Overall, 1H-Pyrido[2,3-b][1,4]oxazin-2-ol represents a class of compounds with significant potential in medicinal chemistry and materials science.
Formula:C7H6N2O2
InChI:InChI=1S/C7H6N2O2/c10-6-4-11-7-5(9-6)2-1-3-8-7/h1-4,9-10H
InChI key:InChIKey=VSCGDMOVBPCMHJ-UHFFFAOYSA-N
SMILES:OC=1NC=2C(OC1)=NC=CC2
Synonyms:- 1H-Pyrido[2,3-b][1,4]oxazin-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
