CymitQuimica logo

CAS 1313712-42-3

:

6-Bromo-3-[(4-methoxyphenyl)methyl]thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione

Description:
6-Bromo-3-[(4-methoxyphenyl)methyl]thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione is a heterocyclic compound characterized by its complex structure, which includes a thieno-pyrimidine core. This compound features a bromine substituent at the 6-position and a 4-methoxyphenylmethyl group at the 3-position, contributing to its unique chemical properties. The presence of the thieno and pyrimidine rings suggests potential biological activity, as many compounds with similar structures are known for their pharmacological effects. The dione functional groups indicate the presence of two carbonyl groups, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. This compound may exhibit solubility in organic solvents, and its reactivity can be influenced by the electron-donating methoxy group and the electron-withdrawing bromine atom. Overall, 6-Bromo-3-[(4-methoxyphenyl)methyl]thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione is of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C14H11BrN2O3S
InChI:InChI=1S/C14H11BrN2O3S/c1-20-9-4-2-8(3-5-9)7-17-13(18)12-10(16-14(17)19)6-11(15)21-12/h2-6H,7H2,1H3,(H,16,19)
InChI key:InChIKey=ACBREPWFFGWEGU-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(=O)N1CC3=CC=C(OC)C=C3)C=C(Br)S2
Synonyms:
  • 6-Bromo-3-[(4-methoxyphenyl)methyl]thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione
  • Thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione, 6-bromo-3-[(4-methoxyphenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.