CymitQuimica logo

CAS 1313712-44-5

:

7-Bromo-2,6-dimethylthieno[3,2-d]pyrimidin-4-amine

Description:
7-Bromo-2,6-dimethylthieno[3,2-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its unique thieno[3,2-d]pyrimidine structure, which incorporates both sulfur and nitrogen atoms in its ring system. The presence of a bromine atom at the 7-position and two methyl groups at the 2 and 6 positions contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit properties typical of pyrimidine derivatives, such as the ability to participate in hydrogen bonding and act as a weak base due to the nitrogen atoms in the ring. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the ring, making it a subject of interest for further research in organic synthesis and drug development. Overall, 7-Bromo-2,6-dimethylthieno[3,2-d]pyrimidin-4-amine represents a valuable scaffold for exploring new chemical entities.
Formula:C8H8BrN3S
InChI:InChI=1S/C8H8BrN3S/c1-3-5(9)6-7(13-3)8(10)12-4(2)11-6/h1-2H3,(H2,10,11,12)
InChI key:InChIKey=ZDPDZMBXDAMDFZ-UHFFFAOYSA-N
SMILES:NC1=C2C(C(Br)=C(C)S2)=NC(C)=N1
Synonyms:
  • Thieno[3,2-d]pyrimidin-4-amine, 7-bromo-2,6-dimethyl-
  • 7-Bromo-2,6-dimethylthieno[3,2-d]pyrimidin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.