CAS 1313712-45-6

1-Propanone, 3-hydroxy-2-phenyl-1-[4-(phenylmethyl)-1-piperazinyl]-

Description:

1-Propanone, 3-hydroxy-2-phenyl-1-[4-(phenylmethyl)-1-piperazinyl]- is a complex organic compound characterized by its structural features that include a propanone backbone, a hydroxyl group, and a piperazine moiety. This compound typically exhibits properties associated with both ketones and alcohols, such as potential solubility in polar solvents due to the hydroxyl group, while the presence of phenyl and piperazine groups may contribute to its lipophilicity and biological activity. The piperazine ring often imparts pharmacological properties, making such compounds of interest in medicinal chemistry, particularly in the development of psychoactive or therapeutic agents. The molecular structure suggests potential interactions with biological targets, which could lead to various applications in pharmaceuticals. Additionally, the compound's stability, reactivity, and potential for forming hydrogen bonds due to the hydroxyl group are important characteristics that influence its behavior in chemical reactions and biological systems. Overall, this compound represents a unique combination of functional groups that may be explored for various chemical and biological applications.

Formula: C₂₀H₂₄N₂O₂

InChI: InChI=1S/C20H24N2O2/c23-16-19(18-9-5-2-6-10-18)20(24)22-13-11-21(12-14-22)15-17-7-3-1-4-8-17/h1-10,19,23H,11-16H2

InChI key: InChIKey=VTOFNIYONRVLCL-UHFFFAOYSA-N

SMILES: C(C(=O)N1CCN(CC2=CC=CC=C2)CC1)(CO)C3=CC=CC=C3

Synonyms:

• 1-Propanone, 3-hydroxy-2-phenyl-1-[4-(phenylmethyl)-1-piperazinyl]-

1-(4-Benzyl-piperazin-1-yl)-3-hydroxy-2-phenyl-propan-1-one

Controlled Product

CAS: 1313712-45-6

Please enquire for more information about 1-(4-Benzyl-piperazin-1-yl)-3-hydroxy-2-phenyl-propan-1-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₀H₂₄N₂O₂

Purity: Min. 95%

Molecular weight: 324.4 g/mol

Ref: 3D-NCC71245