CAS 1313712-47-8
:1,1-Dimethylethyl N-(5,6,7,8-tetrahydro-8-quinolinyl)carbamate
Description:
1,1-Dimethylethyl N-(5,6,7,8-tetrahydro-8-quinolinyl)carbamate, identified by its CAS number 1313712-47-8, is a chemical compound that features a carbamate functional group. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) attached to a nitrogen atom, which is further linked to a quinoline derivative. The quinoline moiety contributes to the compound's potential biological activity, as quinolines are known for their diverse pharmacological properties. The structure suggests that it may exhibit lipophilicity due to the bulky tert-butyl group, which can influence its solubility and permeability in biological systems. Additionally, the presence of the tetrahydroquinoline structure may impart specific stereochemical properties that could affect its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of exploring new therapeutic agents. However, detailed studies on its specific properties, reactivity, and biological activity would be necessary for a comprehensive understanding.
Formula:C14H20N2O2
InChI:InChI=1S/C14H20N2O2/c1-14(2,3)18-13(17)16-11-8-4-6-10-7-5-9-15-12(10)11/h5,7,9,11H,4,6,8H2,1-3H3,(H,16,17)
InChI key:InChIKey=IPGXGELCTJPNDX-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1C=2C(CCC1)=CC=CN2
Synonyms:- Carbamic acid, N-(5,6,7,8-tetrahydro-8-quinolinyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-(5,6,7,8-tetrahydro-8-quinolinyl)carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(5,6,7,8-Tetrahydro-quinolin-8-yl)-carbamic acid tert-butyl ester
CAS:Formula:C14H20N2O2Molecular weight:248.3208
