CAS 1313712-58-1

1,1-Dimethylethyl imidazo[1,2-a]pyridin-2-yl carbonate

Description:

1,1-Dimethylethyl imidazo[1,2-a]pyridin-2-yl carbonate is a chemical compound characterized by its unique structure, which includes an imidazo[1,2-a]pyridine moiety and a carbonate functional group. This compound typically exhibits properties associated with both heterocyclic compounds and carbonates, such as potential biological activity and stability under certain conditions. The presence of the dimethyl group contributes to its steric hindrance, which may influence its reactivity and interactions with other molecules. It is likely to be soluble in organic solvents, given the nature of its functional groups, and may exhibit moderate to high thermal stability. The compound's specific applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and reactivity. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 1,1-Dimethylethyl imidazo[1,2-a]pyridin-2-yl carbonate represents a class of compounds with diverse chemical properties and potential applications in various fields.

Formula: C₁₂H₁₄N₂O₃

InChI: InChI=1S/C12H14N2O3/c1-12(2,3)17-11(15)16-10-8-14-7-5-4-6-9(14)13-10/h4-8H,1-3H3

InChI key: InChIKey=XUVXDFJAAQXUBH-UHFFFAOYSA-N

SMILES: O(C(OC(C)(C)C)=O)C=1N=C2N(C1)C=CC=C2

Synonyms:

• Carbonic acid, 1,1-dimethylethyl imidazo[1,2-a]pyridin-2-yl ester
• 1,1-Dimethylethyl imidazo[1,2-a]pyridin-2-yl carbonate

Carbonic acid tert-butyl ester imidazo[1,2-a]pyridin-2-yl ester

CAS: 1313712-58-1

Formula: C₁₂H₁₄N₂O₃

Molecular weight: 234.2512

Ref: IN-DA009W3F