CAS 1313712-59-2
:Acetic acid, 2-chloro-, (2-aminophenyl)methyl ester
Description:
Acetic acid, 2-chloro-, (2-aminophenyl)methyl ester, identified by its CAS number 1313712-59-2, is an organic compound characterized by the presence of an acetic acid moiety and a chloro substituent on the second carbon, along with a (2-aminophenyl)methyl ester group. This compound typically exhibits properties associated with esters, such as being a colorless liquid with a characteristic odor. It is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic aromatic structure. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. This compound may be of interest in various chemical applications, including synthesis in medicinal chemistry or as an intermediate in organic reactions. Safety data should be consulted for handling, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, its unique structure provides a basis for diverse chemical behavior and potential applications in research and industry.
Formula:C9H10ClNO2
InChI:InChI=1S/C9H10ClNO2/c10-5-9(12)13-6-7-3-1-2-4-8(7)11/h1-4H,5-6,11H2
InChI key:InChIKey=WJWXFNYZQSRZJZ-UHFFFAOYSA-N
SMILES:C(OC(CCl)=O)C1=C(N)C=CC=C1
Synonyms:- Acetic acid, 2-chloro-, (2-aminophenyl)methyl ester
- (2-Aminophenyl)methyl 2-chloroacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.