CymitQuimica logo

CAS 1313712-62-7

:

Ethyl 6-cyclopentylidene-1,4,5,6-tetrahydro-3-cyclopentapyrazolecarboxylate

Description:
Ethyl 6-cyclopentylidene-1,4,5,6-tetrahydro-3-cyclopentapyrazolecarboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole ring and cyclopentyl groups. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and reactivity due to the presence of multiple functional groups. The ethyl ester functional group suggests it may be soluble in organic solvents and could participate in various chemical reactions, including esterification and hydrolysis. Its unique bicyclic structure may contribute to specific interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the presence of the cyclopentylidene moiety may influence its steric and electronic properties, potentially affecting its reactivity and interaction with other molecules. Overall, while specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data, the structural features indicate a compound with diverse potential applications in organic synthesis and pharmacology.
Formula:C14H18N2O2
InChI:InChI=1S/C14H18N2O2/c1-2-18-14(17)13-11-8-7-10(12(11)15-16-13)9-5-3-4-6-9/h2-8H2,1H3,(H,15,16)
InChI key:InChIKey=TVKCNGYEOJFSAE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C2=C(C(CC2)=C3CCCC3)NN1
Synonyms:
  • Ethyl 6-cyclopentylidene-1,4,5,6-tetrahydro-3-cyclopentapyrazolecarboxylate
  • 3-Cyclopentapyrazolecarboxylic acid, 6-cyclopentylidene-1,4,5,6-tetrahydro-, ethyl ester
  • Ethyl 6-cyclopentylidene-1,4,5,6-tetrahydrocyclopenta[c]pyrazole-3-carboxylate
  • 6-Cyclopentylidene-1,4,5,6-tetrahydro-cyclopentapyrazole-3-carboxylic acid
  • ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.