CymitQuimica logo

CAS 1313712-63-8

:

5-[Bis(ethylamino)methylene]-1,3-dibutyl-2,4,6(1H,3H,5H)-pyrimidinetrione

Description:
5-[Bis(ethylamino)methylene]-1,3-dibutyl-2,4,6(1H,3H,5H)-pyrimidinetrione is a synthetic organic compound characterized by its complex structure, which includes a pyrimidinetrione core substituted with ethylamino groups and butyl chains. This compound typically exhibits properties associated with pyrimidine derivatives, such as potential biological activity, including antimicrobial or antitumor effects, due to the presence of the pyrimidine ring and the amino substituents. The ethylamino groups may enhance solubility in organic solvents and influence the compound's reactivity. Additionally, the dibutyl substituents can affect the lipophilicity and overall stability of the molecule. The presence of multiple functional groups suggests that this compound could participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling considerations should also be taken into account, as with any chemical substance.
Formula:C17H30N4O3
InChI:InChI=1S/C17H30N4O3/c1-5-9-11-20-15(22)13(14(18-7-3)19-8-4)16(23)21(17(20)24)12-10-6-2/h18-19H,5-12H2,1-4H3
InChI key:InChIKey=WMAMZHIAVFQYLY-UHFFFAOYSA-N
SMILES:C(NCC)(NCC)=C1C(=O)N(CCCC)C(=O)N(CCCC)C1=O
Synonyms:
  • 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-[bis(ethylamino)methylene]-1,3-dibutyl-
  • 5-[Bis(ethylamino)methylene]-1,3-dibutyl-2,4,6(1H,3H,5H)-pyrimidinetrione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.