CymitQuimica logo

CAS 1313712-65-0

:

6-Ethenyl-3-[[2-(trimethylsilyl)ethoxy]methyl]-3H-1,2,3-triazolo[4,5-b]pyridine

Description:
6-Ethenyl-3-[[2-(trimethylsilyl)ethoxy]methyl]-3H-1,2,3-triazolo[4,5-b]pyridine is a chemical compound characterized by its unique structural features, which include a triazole ring fused to a pyridine moiety. This compound contains an ethenyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of a trimethylsilyl group enhances its stability and solubility, making it suitable for various chemical reactions, particularly in the field of medicinal chemistry and material science. The ethoxy group provides additional functionalization, allowing for further derivatization. This compound may exhibit interesting biological activities due to its heterocyclic structure, which is often associated with pharmacological properties. Its CAS number, 1313712-65-0, allows for easy identification and retrieval of information in chemical databases. Overall, this compound represents a versatile building block for the development of novel pharmaceuticals and agrochemicals, with potential applications in various fields of research and industry.
Formula:C13H20N4OSi
InChI:InChI=1S/C13H20N4OSi/c1-5-11-8-12-13(14-9-11)17(16-15-12)10-18-6-7-19(2,3)4/h5,8-9H,1,6-7,10H2,2-4H3
InChI key:InChIKey=KVZDSQISKJRTCX-UHFFFAOYSA-N
SMILES:C(OCC[Si](C)(C)C)N1C=2C(=CC(C=C)=CN2)N=N1
Synonyms:
  • 6-Ethenyl-3-[[2-(trimethylsilyl)ethoxy]methyl]-3H-1,2,3-triazolo[4,5-b]pyridine
  • 3H-1,2,3-Triazolo[4,5-b]pyridine, 6-ethenyl-3-[[2-(trimethylsilyl)ethoxy]methyl]-
  • 3-(2-TriMethylsilanyl-ethoxyMethyl)-6-vinyl-3H-[1,2,3]triazolo[4,5-b]pyridine
  • 3-((2-(TriMethylsilyl)ethoxy)Methyl)-6-vinyl-3H-[1,2,3]triazolo[4,5-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.