CymitQuimica logo

CAS 1313712-72-9

:

Ethyl 8-bromo-6-nitroimidazo[1,2-a]pyridine-2-carboxylate

Description:
Ethyl 8-bromo-6-nitroimidazo[1,2-a]pyridine-2-carboxylate is a chemical compound characterized by its complex structure, which includes a pyridine ring fused with an imidazole moiety. The presence of a bromine atom and a nitro group contributes to its reactivity and potential biological activity. This compound typically appears as a solid and is soluble in organic solvents, reflecting its polar and non-polar characteristics due to the various functional groups. The ethyl ester group enhances its lipophilicity, which may influence its pharmacokinetic properties. Ethyl 8-bromo-6-nitroimidazo[1,2-a]pyridine-2-carboxylate is of interest in medicinal chemistry, particularly for its potential applications in drug development, especially in the context of antimicrobial or anticancer agents. Its synthesis often involves multi-step organic reactions, and it may be subject to various analytical techniques for characterization, including NMR and mass spectrometry. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C10H8BrN3O4
InChI:InChI=1S/C10H8BrN3O4/c1-2-18-10(15)8-5-13-4-6(14(16)17)3-7(11)9(13)12-8/h3-5H,2H2,1H3
InChI key:InChIKey=KUKFEJRSKIUIIC-UHFFFAOYSA-N
SMILES:BrC=1C=2N(C=C(C(OCC)=O)N2)C=C(N(=O)=O)C1
Synonyms:
  • Ethyl 8-bromo-6-nitroimidazo[1,2-a]pyridine-2-carboxylate
  • Imidazo[1,2-a]pyridine-2-carboxylic acid, 8-bromo-6-nitro-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.