CAS 1313714-60-1
:Methyl 5-(4-fluorophenyl)-2-pentenoate
Description:
Methyl 5-(4-fluorophenyl)-2-pentenoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a pentenoate backbone, indicating the presence of a double bond within a five-carbon chain, and a 4-fluorophenyl substituent, which introduces a fluorine atom on a phenyl ring. The presence of the fluorine atom can influence the compound's reactivity, polarity, and overall biological activity. Methyl 5-(4-fluorophenyl)-2-pentenoate is likely to be a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the presence of both the alkene and aromatic functionalities. Additionally, the compound's properties may be influenced by factors such as temperature and pressure, which can affect its stability and reactivity in various chemical environments.
Formula:C12H13FO2
InChI:InChI=1S/C12H13FO2/c1-15-12(14)5-3-2-4-10-6-8-11(13)9-7-10/h3,5-9H,2,4H2,1H3
InChI key:InChIKey=BHPCQASCGYNZEM-UHFFFAOYSA-N
SMILES:C(CC=CC(OC)=O)C1=CC=C(F)C=C1
Synonyms:- Methyl 5-(4-fluorophenyl)-2-pentenoate
- 2-Pentenoic acid, 5-(4-fluorophenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
