CAS 1313725-98-2

Thieno[3,2-b]pyridine-2-methanamine

Description:

Thieno[3,2-b]pyridine-2-methanamine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a thieno and a pyridine ring. This compound features a methanamine functional group, contributing to its potential reactivity and biological activity. Thieno[3,2-b]pyridine derivatives are often studied for their pharmacological properties, including potential applications in medicinal chemistry, particularly as inhibitors or modulators in various biological pathways. The presence of nitrogen atoms in the pyridine and amine groups enhances its ability to form hydrogen bonds, which can influence its solubility and interaction with biological targets. Additionally, the compound may exhibit properties such as fluorescence or photostability, depending on its specific substituents and structural configuration. Its synthesis typically involves multi-step organic reactions, and it may be evaluated for its efficacy in drug discovery or as a building block for more complex molecules. As with many heterocycles, understanding its reactivity and stability under various conditions is crucial for its application in research and industry.

Formula: C₈H₈N₂S

InChI: InChI=1S/C8H8N2S/c9-5-6-4-7-8(11-6)2-1-3-10-7/h1-4H,5,9H2

InChI key: InChIKey=PJCCIIHILYHGSP-UHFFFAOYSA-N

SMILES: C(N)C1=CC=2C(S1)=CC=CN2

Synonyms:

• Thieno[3,2-b]pyridine-2-methanamine
• [Thieno[3,2-b]pyridin-2-yl]methanamine