
CAS 1313726-10-1
:1-(6-Quinolinyl)cyclopropanamine
Description:
1-(6-Quinolinyl)cyclopropanamine is a chemical compound characterized by its unique structure, which combines a cyclopropanamine moiety with a quinoline ring. The presence of the quinoline group imparts aromatic characteristics, contributing to the compound's potential biological activity. Cyclopropanamines are known for their three-membered ring structure, which can introduce strain and influence reactivity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the cyclic amine and the heterocyclic aromatic system. Its molecular interactions can be influenced by the nitrogen atom in the amine group and the nitrogen in the quinoline, potentially allowing for hydrogen bonding and other interactions with biological targets. Additionally, the compound's solubility, stability, and reactivity can vary based on its functional groups and overall molecular geometry. As with many compounds in this class, further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug discovery and development.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c13-12(5-6-12)10-3-4-11-9(8-10)2-1-7-14-11/h1-4,7-8H,5-6,13H2
InChI key:InChIKey=ZFOTUWRNOLDZFA-UHFFFAOYSA-N
SMILES:NC1(CC1)C2=CC3=C(C=C2)N=CC=C3
Synonyms:- 1-(6-Quinolinyl)cyclopropanamine
- Cyclopropanamine, 1-(6-quinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.