CymitQuimica logo

CAS 1313726-29-2

:

7-(Azidomethyl)[1,2,4]triazolo[1,5-a]pyridine

Description:
7-(Azidomethyl)[1,2,4]triazolo[1,5-a]pyridine is a chemical compound characterized by its unique structural features, which include a triazole ring fused to a pyridine moiety. The presence of the azidomethyl group introduces notable reactivity, particularly in click chemistry applications, where azides can participate in cycloaddition reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The azide functional group is known for its ability to undergo reduction to amines, which can be leveraged in synthetic pathways. Additionally, the compound may exhibit fluorescence properties, depending on its environment and substituents. Safety considerations are paramount when handling azides due to their potential explosiveness under certain conditions. Overall, 7-(Azidomethyl)[1,2,4]triazolo[1,5-a]pyridine represents a versatile building block in organic synthesis and materials science.
Formula:C7H6N6
InChI:InChI=1S/C7H6N6/c8-12-10-4-6-1-2-13-7(3-6)9-5-11-13/h1-3,5H,4H2
InChI key:InChIKey=TWXYYBJNHBGRBB-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])C1=CC=2N(C=C1)N=CN2
Synonyms:
  • 7-(Azidomethyl)[1,2,4]triazolo[1,5-a]pyridine
  • [1,2,4]Triazolo[1,5-a]pyridine, 7-(azidomethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.