CAS 1313726-32-7

3-(Hydroxymethyl)imidazo[1,2-a]pyridine-6-carbonitrile

Description:

3-(Hydroxymethyl)imidazo[1,2-a]pyridine-6-carbonitrile is a heterocyclic organic compound characterized by its imidazole and pyridine rings, which contribute to its aromatic properties and potential biological activity. The presence of a hydroxymethyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The carbonitrile functional group introduces a strong electron-withdrawing character, which can affect the compound's acidity and nucleophilicity. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its structural features suggest that it may exhibit various pharmacological activities, making it a candidate for further research. Additionally, the compound's stability and reactivity can be influenced by the surrounding functional groups, which may play a role in its synthesis and application in various chemical reactions. Overall, 3-(Hydroxymethyl)imidazo[1,2-a]pyridine-6-carbonitrile represents a versatile scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₉H₇N₃O

InChI: InChI=1S/C9H7N3O/c10-3-7-1-2-9-11-4-8(6-13)12(9)5-7/h1-2,4-5,13H,6H2

InChI key: InChIKey=GHJOJXAUQXPGRU-UHFFFAOYSA-N

SMILES: C(O)C=1N2C(=NC1)C=CC(C#N)=C2

Synonyms:

• Imidazo[1,2-a]pyridine-6-carbonitrile, 3-(hydroxymethyl)-
• 3-(Hydroxymethyl)imidazo[1,2-a]pyridine-6-carbonitrile