CymitQuimica logo

CAS 1313726-36-1

:

Methyl 5-(aminomethyl)pyrazolo[1,5-a]pyridine-3-carboxylate

Description:
Methyl 5-(aminomethyl)pyrazolo[1,5-a]pyridine-3-carboxylate is a chemical compound characterized by its pyrazolo-pyridine structure, which features a pyrazole ring fused to a pyridine ring. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the aminomethyl group, which can influence its reactivity and interaction with biological targets. The carboxylate functional group suggests that it may participate in various chemical reactions, such as esterification or amidation. Methyl esters like this compound are often soluble in organic solvents, which can facilitate their use in synthetic applications. Additionally, the presence of nitrogen atoms in the heterocyclic structure may contribute to its pharmacological properties, making it a candidate for research in medicinal chemistry. Overall, this compound's unique structure and functional groups position it as a potentially valuable substance in both synthetic and pharmaceutical chemistry contexts.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c1-15-10(14)8-6-12-13-3-2-7(5-11)4-9(8)13/h2-4,6H,5,11H2,1H3
InChI key:InChIKey=GVVOEZPSDVWJKB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2N(N=C1)C=CC(CN)=C2
Synonyms:
  • Methyl 5-(aminomethyl)pyrazolo[1,5-a]pyridine-3-carboxylate
  • Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 5-(aminomethyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.