
CAS 1313726-74-7
:N4-(2-Methoxyethyl)-2,4-pyridinediamine
Description:
N4-(2-Methoxyethyl)-2,4-pyridinediamine, identified by its CAS number 1313726-74-7, is a chemical compound characterized by its pyridine ring structure, which is substituted with two amino groups and a methoxyethyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the methoxyethyl group enhances its lipophilicity, potentially affecting its biological activity and interaction with cellular membranes. As a pyridine derivative, it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can engage in diverse chemical interactions. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C8H13N3O
InChI:InChI=1S/C8H13N3O/c1-12-5-4-10-7-2-3-11-8(9)6-7/h2-3,6H,4-5H2,1H3,(H3,9,10,11)
InChI key:InChIKey=BBSKNHPDTFMFHT-UHFFFAOYSA-N
SMILES:N(CCOC)C=1C=C(N)N=CC1
Synonyms:- 2,4-Pyridinediamine N4-(2-methoxyethyl)-
- 2,4-Pyridinediamine, N4-(2-methoxyethyl)-
- N4-(2-Methoxyethyl)-2,4-pyridinediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.