CAS 1313738-65-6
:3,4,8-trichloro-1,7-naphthyridine
Description:
3,4,8-Trichloro-1,7-naphthyridine is a heterocyclic compound characterized by a fused bicyclic structure containing nitrogen atoms in its ring system. The presence of three chlorine substituents at the 3, 4, and 8 positions significantly influences its chemical properties, including increased lipophilicity and potential reactivity. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as color and solubility depending on its crystalline form. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The chlorine atoms can enhance its biological activity and stability, making it of interest in medicinal chemistry. Additionally, the presence of the naphthyridine moiety may impart specific electronic properties, affecting its interaction with biological targets. Safety and handling precautions are essential due to the potential toxicity associated with chlorine-containing compounds. As with any chemical, thorough characterization and understanding of its reactivity and environmental impact are crucial for its application and use.
Formula:C8H3Cl3N2
InChI:InChI=1S/C8H3Cl3N2/c9-5-3-13-7-4(6(5)10)1-2-12-8(7)11/h1-3H
InChI key:InChIKey=QNHPZTLZDZFQAO-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C(Cl)=NC=C2)N=CC1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
