CAS 1313738-74-7
:3-(3,4-Dimethoxyphenyl)-1-(2-hydroxy-3-methylphenyl)-2-propen-1-one
Description:
3-(3,4-Dimethoxyphenyl)-1-(2-hydroxy-3-methylphenyl)-2-propen-1-one, identified by its CAS number 1313738-74-7, is an organic compound characterized by its structure, which features a chalcone backbone. This compound typically exhibits a yellow to orange color, indicative of its conjugated double bond system, which can absorb visible light. It is likely to be soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO) but may have limited solubility in water due to its hydrophobic aromatic groups. The presence of methoxy and hydroxyl functional groups suggests potential for hydrogen bonding and may influence its reactivity and biological activity. Chalcones are known for their diverse pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial activities, making this compound of interest in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations for its application in research and potential therapeutic uses.
Formula:C18H18O4
InChI:InChI=1S/C18H18O4/c1-12-5-4-6-14(18(12)20)15(19)9-7-13-8-10-16(21-2)17(11-13)22-3/h4-11,20H,1-3H3
InChI key:InChIKey=IHFYDTMKUXTNAX-UHFFFAOYSA-N
SMILES:C(C=CC1=CC(OC)=C(OC)C=C1)(=O)C2=C(O)C(C)=CC=C2
Synonyms:- 3-(3,4-Dimethoxyphenyl)-1-(2-hydroxy-3-methylphenyl)-2-propen-1-one
- 2-Propen-1-one, 3-(3,4-dimethoxyphenyl)-1-(2-hydroxy-3-methylphenyl)-
- 3-(3,4-diMethoxyphenyl)-1-(2-hydroxy-3-Methylphenyl)prop-2-en-1-one
- (e)-3-(3,4-dimethoxyphenyl)-1-(2-hydroxy-3-methylphenyl)prop-2-en-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3,4-Dimethoxyphenyl)-1-(2-hydroxy-3-methylphenyl)prop-2-en-1-one
CAS:Formula:C18H18O4Molecular weight:298.3331
