CAS 1313738-92-9
:N,N,1-Trimethyl-3-pyrrolidinemethanamine
Description:
N,N,1-Trimethyl-3-pyrrolidinemethanamine, identified by its CAS number 1313738-92-9, is a chemical compound characterized by its pyrrolidine structure, which includes a nitrogen atom in a five-membered ring. This compound features three methyl groups attached to the nitrogen atom, contributing to its tertiary amine classification. It is typically a colorless to pale yellow liquid with a distinctive amine odor. The presence of the pyrrolidine ring imparts certain steric and electronic properties, making it a potential candidate for various applications in organic synthesis and as a building block in pharmaceuticals. The compound is soluble in water and organic solvents, which enhances its versatility in chemical reactions. Additionally, due to the presence of the amine functional group, it can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Safety data should be consulted for handling, as amines can be irritants and may pose health risks. Overall, N,N,1-Trimethyl-3-pyrrolidinemethanamine is an interesting compound with potential utility in various chemical contexts.
Formula:C8H18N2
InChI:InChI=1S/C8H18N2/c1-9(2)6-8-4-5-10(3)7-8/h8H,4-7H2,1-3H3
InChI key:InChIKey=JUAZDBSPGMXQEN-UHFFFAOYSA-N
SMILES:C(N(C)C)C1CN(C)CC1
Synonyms:- 3-Pyrrolidinemethanamine, N,N,1-trimethyl-
- N,N,1-Trimethyl-3-pyrrolidinemethanamine
- N,N-diMethyl-1-(1-Methylpyrrolidin-3-yl)MethanaMine
- N,N-dimethyl(1-methylpyrrolidin-3-yl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.