
CAS 1313738-93-0
:3-Pyrrolidinemethanamine, 3-methyl-, hydrochloride (1:1)
Description:
3-Pyrrolidinemethanamine, 3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a primary amine group, contributing to its basicity and potential reactivity in various chemical reactions. The presence of the methyl group at the third position of the pyrrolidine ring enhances its steric properties and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and biochemistry. The compound may exhibit properties such as being hygroscopic and having a specific melting point, which can be influenced by the presence of the hydrochloride. Its potential uses could include roles in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions, given the structural similarities to other biologically active amines. Safety and handling precautions should be observed, as with any chemical substance, due to its amine functionality.
Formula:C6H14N2·ClH
InChI:InChI=1S/C6H14N2.ClH/c1-6(4-7)2-3-8-5-6;/h8H,2-5,7H2,1H3;1H
InChI key:InChIKey=FRQWHAZEJHQKRP-UHFFFAOYSA-N
SMILES:C(N)C1(C)CCNC1.Cl
Synonyms:- 3-Pyrrolidinemethanamine, 3-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.