CAS 1313738-95-2
:Tetrahydro-4-nitro-2H-pyran
Description:
Tetrahydro-4-nitro-2H-pyran is a heterocyclic organic compound characterized by its pyran ring structure, which is a six-membered ring containing one oxygen atom and five carbon atoms. The presence of a nitro group (-NO2) at the 4-position of the pyran ring contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical reactions. The tetrahydro configuration indicates that the compound is fully saturated, which affects its stability and reactivity compared to unsaturated analogs. Tetrahydro-4-nitro-2H-pyran may be utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique structural features. Safety data should be consulted for handling, as nitro compounds can be sensitive and may pose health risks.
Formula:C5H9NO3
InChI:InChI=1S/C5H9NO3/c7-6(8)5-1-3-9-4-2-5/h5H,1-4H2
InChI key:InChIKey=NEJGJDRGDXBKGD-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1CCOCC1
Synonyms:- Tetrahydro-4-nitro-2H-pyran
- 2H-Pyran, tetrahydro-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
