CAS 1313738-99-6
:6-Iodopyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione
Description:
6-Iodopyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione is a heterocyclic compound characterized by its complex fused ring structure, which includes a pyrrole and triazine moiety. The presence of iodine in its structure contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitutions. This compound typically exhibits properties associated with both aromatic and non-aromatic systems, influencing its stability and reactivity. It may display significant biological activity, making it of interest in medicinal chemistry and drug development. The dione functional groups suggest the potential for tautomerism and involvement in hydrogen bonding, which can affect solubility and interaction with biological targets. Additionally, the compound's unique structure may lead to interesting photophysical properties, making it a candidate for studies in materials science and organic electronics. Overall, 6-Iodopyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione represents a fascinating subject for further research in both synthetic and applied chemistry.
Formula:C6H4IN3O2
InChI:InChI=1S/C6H4IN3O2/c7-3-1-4-5(11)8-6(12)9-10(4)2-3/h1-2H,(H2,8,9,11,12)
InChI key:InChIKey=GYGXRFJMFYTFIB-UHFFFAOYSA-N
SMILES:O=C1C=2N(C=C(I)C2)NC(=O)N1
Synonyms:- 6-Iodopyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione
- Pyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione, 6-iodo-
- 6-iodo-1H,2H,3H,4H-pyrrolo[2,1-f][1,2,4]triazine-2,4-dione
- 6-Iodopyrrolo[2,1-f][1,2,4]triazine-2,4-dione
- 6-iodo-pyrrolo[2,1-f][1,2,4]triazin-2,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.