CAS 1313739-07-9

Ethyl 1-butyl-α-oxo-1H-imidazole-2-acetate

Description:

Ethyl 1-butyl-α-oxo-1H-imidazole-2-acetate is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents and potential reactivity in various chemical reactions. The presence of the α-oxo group indicates that it has a carbonyl functionality adjacent to the imidazole ring, which can enhance its reactivity, particularly in nucleophilic addition reactions. The butyl group attached to the imidazole ring provides hydrophobic characteristics, influencing its interaction with biological systems and its potential applications in pharmaceuticals or agrochemicals. The compound's structure suggests it may exhibit interesting biological activities, although specific biological properties would require empirical investigation. Overall, Ethyl 1-butyl-α-oxo-1H-imidazole-2-acetate represents a versatile scaffold for further chemical modifications and applications in various fields of research.

Formula: C₁₁H₁₆N₂O₃

InChI: InChI=1S/C11H16N2O3/c1-3-5-7-13-8-6-12-10(13)9(14)11(15)16-4-2/h6,8H,3-5,7H2,1-2H3

InChI key: InChIKey=AJDXFSYWTLRZQP-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(=O)C=1N(CCCC)C=CN1

Synonyms:

• Ethyl 1-butyl-α-oxo-1H-imidazole-2-acetate
• 1H-Imidazole-2-acetic acid, 1-butyl-α-oxo-, ethyl ester