CymitQuimica logo

CAS 1313760-65-4

:

N-Propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine

Description:
N-Propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring and a boron-containing moiety. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests that this compound may exhibit properties related to boron chemistry, such as potential applications in organic synthesis or as a reagent in various chemical reactions. The N-propyl substituent indicates that the compound has a moderate hydrophobic character, which may influence its solubility and reactivity in different solvents. Additionally, the amine functional group can participate in hydrogen bonding, potentially affecting its interactions with other molecules. This compound may be of interest in medicinal chemistry or materials science due to its structural features, which could facilitate specific biological activities or the formation of novel materials. However, detailed studies would be necessary to fully understand its properties, reactivity, and potential applications.
Formula:C14H23BN2O2
InChI:InChI=1S/C14H23BN2O2/c1-6-9-16-12-8-7-11(10-17-12)15-18-13(2,3)14(4,5)19-15/h7-8,10H,6,9H2,1-5H3,(H,16,17)
InChI key:InChIKey=DGCVPSDEHVTWFS-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=CC(NCCC)=NC2
Synonyms:
  • 2-Pyridinamine, N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • N-Propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.