CAS 1313761-41-9

B-[2-(2-Phenylethoxy)phenyl]boronic acid

Description:

B-[2-(2-Phenylethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a biphenyl structure with a phenylethoxy substituent, contributing to its hydrophobic properties and potential applications in organic synthesis and medicinal chemistry. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the presence of the phenylethoxy group may enhance solubility in organic solvents and influence the compound's reactivity and selectivity in various chemical reactions. B-[2-(2-Phenylethoxy)phenyl]boronic acid may also exhibit biological activity, which could be explored in drug development or as a tool in chemical biology. Its unique structural features and functional groups make it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₄H₁₅BO₃

InChI: InChI=1S/C14H15BO3/c16-15(17)13-8-4-5-9-14(13)18-11-10-12-6-2-1-3-7-12/h1-9,16-17H,10-11H2

InChI key: InChIKey=DSHRJFXNRCHYTE-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(OCCC2=CC=CC=C2)C=CC=C1

Synonyms:

• B-[2-(2-Phenylethoxy)phenyl]boronic acid
• Boronic acid, B-[2-(2-phenylethoxy)phenyl]-

[2-(2-Phenylethoxy)phenyl]boronic acid

CAS: 1313761-41-9

Versatile small molecule scaffold

Formula: C₁₄H₁₅BO₃

Purity: Min. 95%

Molecular weight: 242.08 g/mol

Ref: 3D-NCC76141