CAS 131379-15-2
:4-(ETHOXYCARBONYL)PHENYLZINC BROMIDE
Description:
4-(Ethoxycarbonyl)phenylzinc bromide is an organozinc compound characterized by its zinc atom bonded to a phenyl group that is further substituted with an ethoxycarbonyl group. This compound typically appears as a colorless to light yellow solid and is known for its reactivity in organic synthesis, particularly in cross-coupling reactions such as the Suzuki reaction. The presence of the ethoxycarbonyl group enhances its nucleophilicity, making it a valuable reagent for forming carbon-carbon bonds. It is soluble in common organic solvents, which facilitates its use in various synthetic applications. As with many organometallic compounds, it should be handled with care due to its potential reactivity with moisture and air, which can lead to decomposition or unwanted side reactions. Proper storage under inert conditions is recommended to maintain its stability. Overall, 4-(ethoxycarbonyl)phenylzinc bromide serves as an important intermediate in the synthesis of complex organic molecules in the field of medicinal chemistry and materials science.
Formula:C9H9BrO2Zn
InChI:InChI=1/C9H9O2.BrH.Zn/c1-2-11-9(10)8-6-4-3-5-7-8;;/h4-7H,2H2,1H3;1H;/q-1;;+2/p-1/rC9H9O2.BrZn/c1-2-11-9(10)8-6-4-3-5-7-8;1-2/h4-7H,2H2,1H3;/q-1;+1
SMILES:CCOC(=O)C1=CC=C=C[CH-]1.Br.[Zn]
Synonyms:- 4-(Ethoxycarbonyl)Phenylzinc Bromide Solution
- Bromozinc(1+) (Ethoxycarbonyl)Benzenide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
