CAS 131379-34-5
:ethyl 4'-cyanobiphenyl-3-carboxylate
Description:
Ethyl 4'-cyanobiphenyl-3-carboxylate, with the CAS number 131379-34-5, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) at the para position relative to the carboxylate group and an ethyl ester functional group contributes to its chemical properties. This compound is typically used in the synthesis of liquid crystals and other advanced materials due to its unique electronic and optical characteristics. It may exhibit specific melting and boiling points, solubility in organic solvents, and reactivity based on its functional groups. Additionally, its structural features may influence its behavior in various chemical reactions, making it of interest in both academic and industrial applications. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C16H13NO2
InChI:InChI=1/C16H13NO2/c1-2-19-16(18)15-5-3-4-14(10-15)13-8-6-12(11-17)7-9-13/h3-10H,2H2,1H3
SMILES:CCOC(=O)c1cccc(c1)c1ccc(cc1)C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
