CAS 131379-35-6

Ethyl 2′-cyano[1,1′-biphenyl]-3-carboxylate

Description:

Ethyl 2′-cyano[1,1′-biphenyl]-3-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a cyano group (-CN) and an ethyl ester functional group, contributing to its reactivity and solubility properties. Typically, it appears as a solid or liquid depending on the specific conditions, and it is often used in organic synthesis and medicinal chemistry due to its potential as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the cyano group enhances its ability to participate in nucleophilic reactions, while the carboxylate moiety can engage in esterification and other transformations. Its chemical behavior is influenced by the electron-withdrawing nature of the cyano group, which can affect the acidity of adjacent protons and the overall reactivity of the molecule. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.

Formula: C₁₆H₁₃NO₂

InChI: InChI=1S/C16H13NO2/c1-2-19-16(18)13-8-5-7-12(10-13)15-9-4-3-6-14(15)11-17/h3-10H,2H2,1H3

InChI key: InChIKey=NRXNJYFEBJWFCD-UHFFFAOYSA-N

SMILES: C(#N)C1=C(C=CC=C1)C2=CC(C(OCC)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 2′-cyano-, ethyl ester
• Ethyl 2′-cyano[1,1′-biphenyl]-3-carboxylate

[1,1'-Biphenyl]-3-carboxylic acid, 2'-cyano-, ethyl ester

CAS: 131379-35-6

Formula: C₁₆H₁₃NO₂

Molecular weight: 251.2799

Ref: IN-DA000W1T

ethyl 2′-cyanobiphenyl-3-carboxylate

CAS: 131379-35-6

Formula: C₁₆H₁₃NO₂

Purity: 97.0%

Molecular weight: 251.285

Ref: 10-F200793