CAS 13138-33-5
:3-Aminopropylphosphonic acid
Description:
3-Aminopropylphosphonic acid is an organophosphorus compound characterized by the presence of both an amino group and a phosphonic acid group. Its molecular structure features a three-carbon chain with an amino group (-NH2) attached to the first carbon and a phosphonic acid group (-PO3H2) attached to the third carbon. This compound is typically a white crystalline solid that is soluble in water, making it useful in various applications, including as a chelating agent and in the synthesis of phosphonate derivatives. It exhibits properties typical of phosphonic acids, such as the ability to form stable complexes with metal ions. Additionally, 3-aminopropylphosphonic acid can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the reactivity of its functional groups. Its biological significance is also notable, as it may play a role in biochemical pathways and has been studied for potential applications in agriculture and medicine.
Formula:C3H9NO3P
InChI:InChI=1/C3H10NO3P/c4-2-1-3-8(5,6)7/h1-4H2,(H2,5,6,7)/p-1
SMILES:C(CN)CP(=O)([O-])O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
(3-Aminopropyl)phosphonic Acid
CAS:Formula:C3H10NO3PPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:139.09Phosphonic acid, P-(3-aminopropyl)-
CAS:Formula:C3H10NO3PPurity:97%Color and Shape:SolidMolecular weight:139.0902(3-Aminopropyl)phosphonic acid
CAS:(3-Aminopropyl)phosphonic acidFormula:C3H10NO3PPurity:98%Color and Shape: white to yellow to gray solidMolecular weight:139.09g/mol3-Aminopropylphosphonic Acid
CAS:3-aminopropylphosphonic acid (3-APPA) is a phosphonic analog of GABA that acts as a partial agonist of GABAB receptors (IC50 = 1.5 μM in a radioligand binding
Formula:C3H10NO3PPurity:99.84%Color and Shape:Light Yellow LiquidMolecular weight:139.093-Aminopropylphosphonic acid
CAS:Formula:H2N(CH2)3P(O)(OH)2Purity:≥ 97.0%Color and Shape:White to off-white or light green powderMolecular weight:139.093-Aminopropylphosphonic acid
CAS:Formula:C3H10NO3PPurity:95%Color and Shape:Solid, White to light yellow solidMolecular weight:139.091(3-Aminopropyl)phosphonic acid
CAS:(3-Aminopropyl)phosphonic acid is an organic compound that is structurally similar to the neurotransmitter gamma-aminobutyric acid (GABA). It is a potent uptake inhibitor of GABA and has been shown to inhibit cancer growth in vitro. The mechanism of action for (3-aminopropyl)phosphonic acid is not fully known, but it has been suggested that it inhibits tumor cell proliferation by binding to ganglion cells and inhibiting their growth. This inhibition may be due to its ability to act as a potent antagonist at the GABA receptor site.
Formula:C3H10NO3PPurity:Min. 95%Color and Shape:White PowderMolecular weight:139.09 g/mol3-Aminopropylphosphonic Acid-13C3
CAS:Controlled ProductFormula:C3H4NO3PColor and Shape:NeatMolecular weight:136.02







