CAS 13138-37-9
:P-(1-Aminopentyl)phosphonic acid
Description:
P-(1-Aminopentyl)phosphonic acid, with the CAS number 13138-37-9, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group and an aminoalkyl side chain. This compound typically exhibits properties associated with both phosphonic acids and amines, including potential solubility in polar solvents due to its ionic nature. It is likely to participate in various chemical reactions, such as nucleophilic substitutions and coordination with metal ions, owing to the presence of the amino group. The phosphonic acid moiety can engage in hydrogen bonding and may exhibit acidic behavior, contributing to its reactivity and potential applications in fields such as agriculture, where it may act as a plant growth regulator or herbicide. Additionally, its structural features may allow it to interact with biological systems, making it of interest in medicinal chemistry and biochemistry. Overall, P-(1-Aminopentyl)phosphonic acid represents a versatile compound with potential utility in various chemical and biological applications.
Formula:C5H14NO3P
InChI:InChI=1S/C5H14NO3P/c1-2-3-4-5(6)10(7,8)9/h5H,2-4,6H2,1H3,(H2,7,8,9)
InChI key:InChIKey=NXTPDFMZKSLVRK-UHFFFAOYSA-N
SMILES:C(P(=O)(O)O)(CCCC)N
Synonyms:- Phosphonic acid, P-(1-aminopentyl)-
- NSC 133880
- Phosphonic acid, (1-aminopentyl)-
- P-(1-Aminopentyl)phosphonic acid
- (1-Aminopentyl)phosphonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
