CymitQuimica logo

CAS 13138-51-7

:

1,2,3,3-Tetrachlorobutane

Description:
1,2,3,3-Tetrachlorobutane is a chlorinated organic compound characterized by the presence of four chlorine atoms attached to a four-carbon butane backbone. Its molecular structure features two chlorine atoms on the first carbon and two on the third carbon, resulting in a highly substituted alkane. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its stability and resistance to degradation, which can pose environmental concerns. 1,2,3,3-Tetrachlorobutane is primarily used in industrial applications, including as a solvent and in the synthesis of other chemical compounds. Due to its chlorinated nature, it may exhibit toxicity and potential health risks upon exposure, necessitating careful handling and adherence to safety regulations. Its physical properties, such as boiling point and solubility, are influenced by the presence of chlorine atoms, which increase the compound's density and alter its reactivity compared to non-chlorinated hydrocarbons.
Formula:C4H6Cl4
InChI:InChI=1S/C4H6Cl4/c1-4(7,8)3(6)2-5/h3H,2H2,1H3
InChI key:InChIKey=NGAAIHKWQFLRDY-UHFFFAOYSA-N
SMILES:C(C(C)(Cl)Cl)(CCl)Cl
Synonyms:
  • 1,2,3,3-Tetrachlorobutane
  • Butane, 1,2,3,3-tetrachloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.