CymitQuimica logo

CAS 13139-27-0

:

Z-Ala-NH2

Description:
Z-Ala-NH2, also known as Z-L-Alanine amide, is a derivative of the amino acid alanine, where the amino group is protected by a benzyloxycarbonyl (Z) group. This compound is characterized by its amide functional group, which contributes to its stability and solubility in various solvents. Z-Ala-NH2 is typically used in peptide synthesis and as an intermediate in the production of pharmaceuticals and biochemicals. The Z group serves as a protective group, allowing for selective reactions at other functional sites on the molecule. This compound is generally stable under standard laboratory conditions but may be sensitive to strong acids or bases, which can lead to the cleavage of the protective Z group. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. As with many amino acid derivatives, Z-Ala-NH2 can participate in various chemical reactions, including coupling reactions to form peptides, making it a valuable building block in organic synthesis.
Formula:C11H14N2O3
InChI:InChI=1S/C11H14N2O3/c1-8(10(12)14)13-11(15)16-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,12,14)(H,13,15)/t8-/m0/s1
InChI key:CTZZSWNVVFTJRN-QMMMGPOBSA-N
SMILES:C[C@@H](C(=O)N)NC(=O)OCC1=CC=CC=C1
Synonyms:
  • Z-L-alanine amide
Found 4 products.