CAS 13139-47-4

2-acetylthiazole-4-carboxylic acid

Description:

2-Acetylthiazole-4-carboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features an acetyl group and a carboxylic acid functional group, contributing to its reactivity and potential applications in various chemical reactions. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The thiazole moiety can participate in various chemical transformations, making this compound of interest in synthetic organic chemistry. Additionally, its derivatives may possess biological activity, which could be explored for pharmaceutical applications. The compound's molecular structure allows for potential interactions with biological targets, making it a candidate for further research in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₆H₅NO₃S

InChI: InChI=1/C6H5NO3S/c1-3(8)5-7-4(2-11-5)6(9)10/h2H,1H3,(H,9,10)

Synonyms:

• 2-Atca
• 2-acetyl-1,3-thiazole-4-carboxylic acid
• 4-Thiazolecarboxylic acid, 2-acetyl-
• 2-Acetylthiazole-4-carboxylic acid

2-Acetylthiazole-4-carboxylic acid

CAS: 13139-47-4

Formula: C₆H₅NO₃S

Molecular weight: 171.1738

Ref: IN-DA000W2G

2-Acetyl-1,3-thiazole-4-carboxylic acid

CAS: 13139-47-4

2-Acetyl-1,3-thiazole-4-carboxylic acid is a carbonyl compound that is structurally related to other algicides. It has been shown to be effective against marine bacteria and organisms, including algae, bacteria and fungi. The 2-acetyl derivative of 1,3-thiazole has been found to have the highest activity among the derivatives tested. The chemical structure of this compound is similar to that of methyl ester and can be easily hydrolyzed by alkaline solutions. 2-Acetyl-1,3-thiazole-4-carboxylic acid also reacts with oxygen in air to form an unstable oxide which decomposes into water and carbon dioxide. This characteristic makes it suitable for use as an algicide because it can be easily decomposed by sunlight or UV light.

Formula: C₆H₅NO₃S

Purity: Min. 95%

Molecular weight: 171.18 g/mol

Ref: 3D-NAA13947