CAS 13139-94-1
:2-Oxononanoic acid
Description:
2-Oxononanoic acid, also known as nonanedioic acid or nonanoic acid with a keto group at the second carbon, is a carboxylic acid characterized by its long hydrocarbon chain and a ketone functional group. This compound typically exhibits properties common to fatty acids, such as being a colorless to pale yellow liquid or solid at room temperature, depending on its specific form and purity. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic alkyl chain. The presence of the keto group contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and oxidation. 2-Oxononanoic acid may be used in the synthesis of surfactants, plasticizers, and other chemical intermediates. Its applications can extend to the food and cosmetic industries, where it may serve as a flavoring agent or fragrance component. As with many organic acids, it may exhibit mild toxicity, necessitating appropriate handling and safety measures during use.
Formula:C9H16O3
InChI:InChI=1S/C9H16O3/c1-2-3-4-5-6-7-8(10)9(11)12/h2-7H2,1H3,(H,11,12)
InChI key:InChIKey=SHDOPXQMNJDYDK-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)=O)CCCCCC
Synonyms:- Nonanoic acid, 2-oxo-
- 2-Ketononanoic acid
- α-Oxononanoic acid
- 2-Oxononanoic acid
- Preparation 2149
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Oxononanoic acid
CAS:<p>2-Oxononanoic acid is a fatty acid that inhibits the binding of diagnostic agents to interleukin receptors. 2-Oxononanoic acid has been shown to inhibit the production of reactive oxygen species, which may be due to its acidic pH. This compound also inhibits the release of inflammatory mediators, such as cytokines and arachidonic acid metabolites. 2-Oxononanoic acid has been shown to have therapeutic potential in autoimmune diseases and infectious diseases, such as HIV/AIDS. 2-Oxononanoic acid is an affinity ligand for fatty acids and can be used in conjugates with antibodies or antigens for diagnostic purposes or therapy.</p>Formula:C9H16O3Purity:Min. 95%Molecular weight:172.22 g/molRef: 3D-NAA13994
Discontinued product

