CAS 131401-54-2
:1,4-difluoro-5,8-dihydroxyanthracene-9,10-dione
Description:
1,4-Difluoro-5,8-dihydroxyanthracene-9,10-dione is an organic compound belonging to the anthraquinone class, characterized by its distinct structural features, including two fluorine atoms and two hydroxyl groups attached to the anthracene backbone. This compound exhibits a deep color, typical of many anthraquinones, and is known for its potential applications in dyeing, pigments, and as a precursor in organic synthesis. The presence of fluorine atoms can enhance the compound's stability and alter its electronic properties, making it of interest in materials science and organic electronics. The hydroxyl groups contribute to its solubility in polar solvents and can participate in hydrogen bonding, influencing its reactivity and interaction with other chemical species. Additionally, the compound may exhibit interesting photophysical properties, such as fluorescence or phosphorescence, which can be exploited in various applications, including sensors and light-emitting devices. Overall, 1,4-difluoro-5,8-dihydroxyanthracene-9,10-dione is a versatile compound with significant potential in both research and industrial applications.
Formula:C14H6F2O4
InChI:InChI=1/C14H6F2O4/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4,17-18H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,4-Difluoro-5,8-dihydroxyanthracene-9,10-dione
CAS:Formula:C14H6F2O4Color and Shape:SolidMolecular weight:276.1918
