CAS 131401-55-3
:N,N-Diethyl-2,5-difluorobenzamide
Description:
N,N-Diethyl-2,5-difluorobenzamide is an organic compound characterized by its amide functional group and the presence of two fluorine atoms on a benzene ring. The molecular structure features a benzene ring substituted at the 2 and 5 positions with fluorine atoms, while the nitrogen atom is bonded to two ethyl groups. This compound is typically a solid at room temperature and is known for its relatively low solubility in water due to the hydrophobic nature of the ethyl groups and the aromatic ring. The presence of fluorine atoms can enhance the compound's stability and influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Its unique properties may also contribute to its potential as a building block in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can exhibit specific toxicological profiles.
Formula:C11H13F2NO
InChI:InChI=1S/C11H13F2NO/c1-3-14(4-2)11(15)9-7-8(12)5-6-10(9)13/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=JEEJMEMWBHLCKZ-UHFFFAOYSA-N
SMILES:C(N(CC)CC)(=O)C1=C(F)C=CC(F)=C1
Synonyms:- 2,5-Difluoro-N,N-diethylbenzamide
- Benzamide, N,N-diethyl-2,5-difluoro-
- N,N-Diethyl-2,5-difluorobenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.