CAS 131403-76-4
:5-(4-methoxyphenyl)pyrrolo (2,1-D)*(1,5) benzothi
Description:
5-(4-Methoxyphenyl)pyrrolo(2,1-D)(1,5)benzothi is a chemical compound characterized by its complex structure, which includes a pyrrole ring fused with a benzothiophene moiety. The presence of the 4-methoxyphenyl group contributes to its aromatic character and may influence its solubility and reactivity. This compound is likely to exhibit interesting biological activities due to its unique structural features, which can facilitate interactions with various biological targets. The methoxy group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, the compound may possess specific electronic properties due to the conjugation within its aromatic systems, which could be relevant in applications such as organic electronics or as a precursor in organic synthesis. As with many heterocyclic compounds, its reactivity can be influenced by the presence of functional groups and the overall electronic distribution within the molecule. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or materials science.
Formula:C21H17NO3S
InChI:InChI=1/C21H17NO3S/c1-14(23)25-20-18-7-5-13-22(18)17-6-3-4-8-19(17)26-21(20)15-9-11-16(24-2)12-10-15/h3-13H,1-2H3
SMILES:CC(=O)OC1=C(c2ccc(cc2)OC)Sc2ccccc2n2cccc12
Synonyms:- 7-Acetoxy-6,7-dihydro-6-(4-methoxyphenyl)pyrrolo(2,1-d)(1,5)benzothiazepine
- 6-Admpb
- 7-Acetoxy-6-(p-methoxyphenyl)pyrrolo(2,1-d)(1,5)benzothiazepine
- Pyrrolo(2,1-d)(1,5)benzothiazepin-7-ol, 6-(4-methoxyphenyl)-, acetate (ester)
- 6-(4-Methoxyphenyl)Pyrrolo[2,1-D][1,5]Benzothiazepin-7-Yl Acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyrrolo[2,1-d][1,5]benzothiazepin-7-ol, 6-(4-methoxyphenyl)-, 7-acetate
CAS:Formula:C21H17NO3SMolecular weight:363.4296
