CymitQuimica logo

CAS 131403-79-7

:

Pyrrolo[2,1-d][1,5]benzothiazepin-7-ol, 6,7-dihydro-6-(4-methoxyphenyl)-, cis-

Description:
Pyrrolo[2,1-d][1,5]benzothiazepin-7-ol, 6,7-dihydro-6-(4-methoxyphenyl)-, cis- is a complex organic compound characterized by its unique bicyclic structure that incorporates both a benzothiazepine and a pyrrole moiety. This compound features a hydroxyl group (-OH) at the 7-position and a methoxyphenyl group at the 6-position, contributing to its potential biological activity. The presence of the methoxy group enhances lipophilicity, which may influence its pharmacokinetic properties. The cis configuration indicates specific stereochemistry, which can be crucial for its interaction with biological targets. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in treating neurological or psychiatric disorders, although specific biological activities would require further investigation. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions and the presence of other functional groups.
Formula:C19H17NO2S
InChI:InChI=1/C19H17NO2S/c1-22-14-10-8-13(9-11-14)19-18(21)16-6-4-12-20(16)15-5-2-3-7-17(15)23-19/h2-12,18-19,21H,1H3/t18-,19-/s2
InChI key:InChIKey=BGBGSDYFNXHIKG-PVIFGLDDNA-N
SMILES:O[C@H]1C=2N(C=3C(S[C@H]1C4=CC=C(OC)C=C4)=CC=CC3)C=CC2
Synonyms:
  • Pyrrolo[2,1-d][1,5]benzothiazepin-7-ol, 6,7-dihydro-6-(4-methoxyphenyl)-, cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.