CymitQuimica logo

CAS 13141-08-7

:

3-methoxy-2-methylpropanal

Description:
3-Methoxy-2-methylpropanal, with the CAS number 13141-08-7, is an organic compound characterized by its aldehyde functional group and ether moiety. It features a branched carbon chain, which contributes to its unique properties. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents and may influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. This compound typically exhibits a mild, pleasant odor, characteristic of many aldehydes, and is often used in flavoring and fragrance applications. Its molecular structure suggests it may participate in typical aldehyde reactions, such as oxidation and condensation. Additionally, 3-methoxy-2-methylpropanal's relatively low molecular weight and moderate volatility indicate that it can exist as a liquid at room temperature, making it suitable for use in various industrial and laboratory settings. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H10O2
InChI:InChI=1/C5H10O2/c1-5(3-6)4-7-2/h3,5H,4H2,1-2H3
SMILES:CC(C=O)COC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.