CymitQuimica logo

CAS 13141-38-3

:

Benzenamine, 2-(phenylethynyl)-

Description:
Benzenamine, 2-(phenylethynyl)-, also known as 2-(phenylethynyl)aniline, is an organic compound characterized by the presence of an aniline group (an amino group attached to a benzene ring) and a phenylethynyl substituent. This compound features a triple bond between the carbon atoms of the ethynyl group, contributing to its reactivity and potential applications in organic synthesis and materials science. It typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic properties due to the presence of multiple benzene rings. The compound may exhibit moderate solubility in organic solvents and is generally stable under standard conditions, although it may be sensitive to light and air. Its chemical structure allows for various functionalization reactions, making it a valuable intermediate in the synthesis of dyes, pharmaceuticals, and other organic materials. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C14H11N
InChI:InChI=1S/C14H11N/c15-14-9-5-4-8-13(14)11-10-12-6-2-1-3-7-12/h1-9H,15H2
InChI key:BZDTZZOSIAUOBS-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C#CC2=CC=CC=C2N
Found 5 products.