CAS 13141-86-1: 1-(4-nitrophenyl)-3-propylurea
Description:1-(4-Nitrophenyl)-3-propylurea, with the CAS number 13141-86-1, is an organic compound characterized by its urea structure, which includes a propyl group and a para-nitrophenyl substituent. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitrophenyl group contributes to its chemical reactivity and may influence its biological activity. It is generally soluble in organic solvents but may have limited solubility in water, which is a common trait for many urea derivatives. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Safety data sheets should be consulted for handling and storage guidelines, as compounds with nitro groups can exhibit toxicity and require careful management. Overall, 1-(4-nitrophenyl)-3-propylurea represents a significant structure in organic chemistry, with implications for research and development in various scientific domains.
Formula:C10H13N3O3
InChI:InChI=1/C10H13N3O3/c1-2-7-11-10(14)12-8-3-5-9(6-4-8)13(15)16/h3-6H,2,7H2,1H3,(H2,11,12,14)
- Synonyms:
- urea, N-(4-nitrophenyl)-N'-propyl-
- 1-(4-Nitrophenyl)-3-propylurea
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | LC PestiMix 4 10 µg/mL in Acetonitrile REF: 04-A50000804ALCAS: | - - - | To inquire | Fri 02 May 25 |
LC PestiMix 4 10 µg/mL in Acetonitrile
Ref: 04-A50000804AL
| 1ml | To inquire |
