CAS 13141-87-2

N-(4-Nitrophenyl)-N′-(phenylmethyl)urea

Description:

N-(4-Nitrophenyl)-N′-(phenylmethyl)urea, with the CAS number 13141-87-2, is an organic compound characterized by its urea functional group, which is substituted with a 4-nitrophenyl group and a phenylmethyl group. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitrophenyl group imparts notable electronic properties, making it a candidate for studies involving electron transfer and reactivity. Its structure suggests that it may exhibit specific interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the compound's solubility and stability in different solvents can vary, influencing its practical applications. Safety data should be consulted, as compounds with nitro groups can sometimes exhibit toxicity or environmental concerns. Overall, N-(4-Nitrophenyl)-N′-(phenylmethyl)urea is a compound of interest in chemical research due to its unique structural features and potential utility.

Formula: C₁₄H₁₃N₃O₃

InChI: InChI=1S/C14H13N3O3/c18-14(15-10-11-4-2-1-3-5-11)16-12-6-8-13(9-7-12)17(19)20/h1-9H,10H2,(H2,15,16,18)

InChI key: InChIKey=GAKHJIGQGDIDSH-UHFFFAOYSA-N

SMILES: N(C(NCC1=CC=CC=C1)=O)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• Urea, N-(4-nitrophenyl)-N′-(phenylmethyl)-
• 1-Benzyl-3-(4-nitrophenyl)urea
• N-(4-Nitrophenyl)-N′-(phenylmethyl)urea
• Urea, 1-benzyl-3-(p-nitrophenyl)-