CAS 13142-55-7
:N-(2,5-Dichlorophenyl)urea
Description:
N-(2,5-Dichlorophenyl)urea, with the CAS number 13142-55-7, is an organic compound characterized by its urea functional group attached to a dichlorophenyl moiety. This substance typically appears as a white to off-white crystalline solid. It is known for its role in various chemical applications, particularly in the field of agrochemicals, where it may function as a herbicide or plant growth regulator. The presence of chlorine atoms in the phenyl ring enhances its biological activity and stability. N-(2,5-Dichlorophenyl)urea is generally soluble in organic solvents but has limited solubility in water, which influences its environmental behavior and bioavailability. Its chemical structure allows for interactions with biological systems, making it a subject of study in toxicology and environmental science. Safety data sheets indicate that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound exemplifies the intersection of organic chemistry and practical applications in agriculture and environmental management.
Formula:C7H6Cl2N2O
InChI:InChI=1S/C7H6Cl2N2O/c8-4-1-2-5(9)6(3-4)11-7(10)12/h1-3H,(H3,10,11,12)
InChI key:InChIKey=MSPLDOXAOBJWDV-UHFFFAOYSA-N
SMILES:N(C(N)=O)C1=C(Cl)C=CC(Cl)=C1
Synonyms:- (2,5-Dichlorophenyl)urea
- Urea, N-(2,5-dichlorophenyl)-
- Urea, (2,5-dichlorophenyl)-
- NSC 406896
- N-(2,5-Dichlorophenyl)urea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
