
CAS 13142-58-0
:N-(3,5-Dichlorophenyl)-N′-phenylurea
Description:
N-(3,5-Dichlorophenyl)-N′-phenylurea, with the CAS number 13142-58-0, is an organic compound that belongs to the class of ureas. This substance is characterized by the presence of a urea functional group, which consists of a carbonyl group (C=O) flanked by two amine groups (NH2). The compound features a dichlorophenyl group, which contributes to its chemical properties and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of chlorine atoms in the aromatic ring can influence its reactivity and stability, making it of interest in various applications, including agricultural chemistry as a herbicide or plant growth regulator. Additionally, its structural characteristics may impart specific interactions with biological systems, making it a subject of study in medicinal chemistry. Safety and handling precautions are essential due to potential toxicity and environmental impact associated with chlorinated compounds.
Formula:C13H10Cl2N2O
InChI:InChI=1S/C13H10Cl2N2O/c14-9-6-10(15)8-12(7-9)17-13(18)16-11-4-2-1-3-5-11/h1-8H,(H2,16,17,18)
InChI key:InChIKey=HXAALNHUNDFNAG-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=CC=C1)=O)C2=CC(Cl)=CC(Cl)=C2
Synonyms:- 1-(3,5-Dichloro-phenyl)-3-phenyl-urea
- Carbanilide, 3,5-dichloro-
- N-(3,5-Dichlorophenyl)-N′-phenylurea
- 3,5-Dichlorocarbanilide
- Urea, N-(3,5-dichlorophenyl)-N′-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.