
CAS 13142-74-0
:N-(4-Methyl-2-nitrophenyl)urea
Description:
N-(4-Methyl-2-nitrophenyl)urea, with the CAS number 13142-74-0, is an organic compound characterized by its urea functional group attached to a substituted aromatic ring. The presence of a nitro group and a methyl group on the phenyl ring contributes to its chemical properties, influencing its reactivity and solubility. This compound typically appears as a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals, due to the presence of both the urea and nitrophenyl moieties, which can participate in diverse chemical reactions. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, can vary based on environmental conditions and purity. Safety data should be consulted to understand its toxicity and handling precautions, as nitro-substituted compounds can exhibit hazardous properties. Overall, N-(4-Methyl-2-nitrophenyl)urea is a compound of interest in synthetic chemistry and material science.
Formula:C8H9N3O3
InChI:InChI=1S/C8H9N3O3/c1-5-2-3-6(10-8(9)12)7(4-5)11(13)14/h2-4H,1H3,(H3,9,10,12)
InChI key:InChIKey=SIJVYJRLCZOLCS-UHFFFAOYSA-N
SMILES:N(C(N)=O)C1=C(N(=O)=O)C=C(C)C=C1
Synonyms:- N-(4-Methyl-2-nitrophenyl)urea
- Urea, (2-nitro-p-tolyl)-
- Urea, (4-methyl-2-nitrophenyl)-
- Urea, N-(4-methyl-2-nitrophenyl)-
- (4-Methyl-2-nitro-phenyl)-urea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
